Structure of PDB 1red Chain B Binding Site BS01 |
|
|
Ligand ID | C5X |
InChI | InChI=1S/C10H18O6/c11-7-5-16-10(9(13)8(7)12)14-3-1-2-6-4-15-6/h6-13H,1-5H2/t6-,7-,8+,9-,10-/m1/s1 |
InChIKey | DMNHSULDBMDHLY-HOTMZDKISA-N |
SMILES | Software | SMILES |
---|
ACDLabs 10.04 | O(CCCC1OC1)C2OCC(O)C(O)C2O | OpenEye OEToolkits 1.5.0 | C1[C@H](O1)CCCO[C@H]2[C@@H]([C@H]([C@@H](CO2)O)O)O | CACTVS 3.341 | O[C@@H]1CO[C@@H](OCCC[C@@H]2CO2)[C@H](O)[C@H]1O | CACTVS 3.341 | O[CH]1CO[CH](OCCC[CH]2CO2)[CH](O)[CH]1O | OpenEye OEToolkits 1.5.0 | C1C(O1)CCCOC2C(C(C(CO2)O)O)O |
|
Formula | C10 H18 O6 |
Name | 3-[(2R)-oxiran-2-yl]propyl beta-D-xylopyranoside; 4,5-EPOXYPENTYL-BETA-D-XYLOSIDE; 3-[(2R)-oxiran-2-yl]propyl beta-D-xyloside; 3-[(2R)-oxiran-2-yl]propyl D-xyloside; 3-[(2R)-oxiran-2-yl]propyl xyloside |
ChEMBL | |
DrugBank | |
ZINC | ZINC000033821242
|
PDB chain | 1red Chain B Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|