Structure of PDB 1oge Chain B Binding Site BS01 |
|
|
Ligand ID | RP5 |
InChI | InChI=1S/C5H11O8P/c6-3-2(1-12-14(9,10)11)13-5(8)4(3)7/h2-8H,1H2,(H2,9,10,11)/t2-,3-,4-,5-/m1/s1 |
InChIKey | KTVPXOYAKDPRHY-TXICZTDVSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | O[CH]1O[CH](CO[P](O)(O)=O)[CH](O)[CH]1O | OpenEye OEToolkits 1.7.0 | C([C@@H]1[C@H]([C@H]([C@@H](O1)O)O)O)OP(=O)(O)O | OpenEye OEToolkits 1.7.0 | C(C1C(C(C(O1)O)O)O)OP(=O)(O)O | CACTVS 3.370 | O[C@@H]1O[C@H](CO[P](O)(O)=O)[C@@H](O)[C@H]1O | ACDLabs 12.01 | O=P(O)(O)OCC1OC(O)C(O)C1O |
|
Formula | C5 H11 O8 P |
Name | 5-O-phosphono-beta-D-ribofuranose; [(2R,3S,4S,5R)-3,4,5-TRIHYDROXYTETRAHYDROFURAN-2-YL]METHYL DIHYDROGEN PHOSPHATE; 5-O-phosphono-beta-D-ribose; 5-O-phosphono-D-ribose; 5-O-phosphono-ribose |
ChEMBL | CHEMBL1235722 |
DrugBank | DB04352 |
ZINC | ZINC000004228241
|
PDB chain | 1oge Chain B Residue 1132
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
5.4.99.62: D-ribose pyranase. |
|
|
|