Structure of PDB 1m7d Chain B Binding Site BS01 |
|
|
Ligand ID | RAE |
InChI | InChI=1S/C6H12O4/c1-3-6(9)4(7)2-5(8)10-3/h3-9H,2H2,1H3/t3-,4-,5+,6-/m0/s1 |
InChIKey | FDWRIIDFYSUTDP-AZGQCCRYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | OC1C(OC(O)CC1O)C | CACTVS 3.370 | C[CH]1O[CH](O)C[CH](O)[CH]1O | OpenEye OEToolkits 1.7.6 | C[C@H]1[C@@H]([C@H](C[C@@H](O1)O)O)O | CACTVS 3.370 | C[C@@H]1O[C@@H](O)C[C@H](O)[C@H]1O | OpenEye OEToolkits 1.7.6 | CC1C(C(CC(O1)O)O)O |
|
Formula | C6 H12 O4 |
Name | alpha-L-Olivopyranose; alpha-L-Olivose; 2,6-dideoxy-alpha-L-arabino-hexopyranose; 2,6-dideoxy-alpha-L-glucopyranose; 2,6-dideoxy-alpha-L-mannopyranose; 2-deoxy-alpha-L-quinovopyranose; 2-deoxy-alpha-L-rhamnoopyranose; L-Olivose; Olivose; 2-DEOXY-ALPHA-RHAMNOSE |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 1m7d Chain C Residue 2
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|