Structure of PDB 1hl9 Chain B Binding Site BS01 |
|
|
Ligand ID | FUF |
InChI | InChI=1S/C6H11FO4/c1-2-4(8)5(9)3(7)6(10)11-2/h2-6,8-10H,1H3/t2-,3-,4+,5-,6-/m0/s1 |
InChIKey | IRKXGKIPOMIQOD-QYESYBIKSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.341 | C[C@@H]1O[C@H](O)[C@@H](F)[C@H](O)[C@@H]1O | OpenEye OEToolkits 1.5.0 | C[C@H]1[C@H]([C@H]([C@@H]([C@H](O1)O)F)O)O | ACDLabs 10.04 | FC1C(O)C(O)C(OC1O)C | CACTVS 3.341 | C[CH]1O[CH](O)[CH](F)[CH](O)[CH]1O | OpenEye OEToolkits 1.5.0 | CC1C(C(C(C(O1)O)F)O)O |
|
Formula | C6 H11 F O4 |
Name | 2-deoxy-2-fluoro-beta-L-fucopyranose; 2,6-DIDEOXY-2-FLUORO-BETA-L-LYXO-HEXOPYRANOSE; 2,6-dideoxy-2-fluoro-beta-L-galactopyranose; 2-deoxy-2-fluoro-beta-L-fucose; 2-deoxy-2-fluoro-L-fucose; 2-deoxy-2-fluoro-fucose |
ChEMBL | |
DrugBank | |
ZINC | ZINC000006499605
|
PDB chain | 1hl9 Chain B Residue 1449
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
3.2.1.51: alpha-L-fucosidase. |
|
|
|