Structure of PDB 8oms Chain AAA Binding Site BS01 |
|
|
|
| Ligand ID | VTU |
| InChI | InChI=1S/2C8H11NO2.2O.V/c2*1-3-6-8(11)7(10)4-5-9(6)2;;;/h2*4-5,11H,3H2,1-2H3;;;/q;;;;+4/p-2 |
| InChIKey | AZLTYIAFEATFKJ-UHFFFAOYSA-L |
| SMILES | | Software | SMILES |
|---|
| OpenEye OEToolkits 2.0.7 | CCC1=C2C(=[O-][V+4]3(=O)(=O)(O2)[O-]=C4C=CN(C(=C4O3)CC)C)C=CN1C | | CACTVS 3.385 | CCC1=C2O[V+4]3(=O)(=O)(OC4=C(CC)N(C)C=CC4=[O-]3)[O-]=C2C=CN1C |
|
| Formula | C16 H20 N2 O6 V |
| Name | bis-[(1-methyl-2-ethyl-3-hydroxy-4(1H)-pyridinone)]-V(IV)O2;
2,2'-diethyl-3,3'-dimethyl-8,8'-spirobi[7$l^{3},9-dioxa-3-aza-8$l^{8}-vanadabicyclo[4.3.0]nona-1,4,6-triene] 8,8-dioxide |
| ChEMBL | |
| DrugBank | |
| ZINC |
|
| PDB chain | 8oms Chain AAA Residue 201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
| Enzyme Commision number |
3.2.1.17: lysozyme. |
|
|
|
|
|
