Structure of PDB 8ohw Chain AAA Binding Site BS01 |
|
|
Ligand ID | VON |
InChI | InChI=1S/C6H11NO5/c8-3-2(6(11)12)1-7-5(10)4(3)9/h2-5,7-10H,1H2,(H,11,12)/t2-,3-,4-,5+/m0/s1 |
InChIKey | ZIPHSWANMLXHEB-NEEWWZBLSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | C1[C@@H]([C@@H]([C@@H]([C@H](N1)O)O)O)C(=O)O | CACTVS 3.385 | O[C@H]1NC[C@@H]([C@H](O)[C@@H]1O)C(O)=O | OpenEye OEToolkits 2.0.7 | C1C(C(C(C(N1)O)O)O)C(=O)O | CACTVS 3.385 | O[CH]1NC[CH]([CH](O)[CH]1O)C(O)=O |
|
Formula | C6 H11 N O5 |
Name | (3~{S},4~{S},5~{S},6~{R})-4,5,6-tris(oxidanyl)piperidine-3-carboxylic acid |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 8ohw Chain AAA Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|