Structure of PDB 7zg2 Chain AAA Binding Site BS01 |
|
|
Ligand ID | 8WS |
InChI | InChI=1S/C11H21N3O3/c1-8(15)13-7-5-4-6-10(11(17)12-3)14-9(2)16/h10H,4-7H2,1-3H3,(H,12,17)(H,13,15)(H,14,16)/t10-/m0/s1 |
InChIKey | RWBIXQSLRNBRKV-JTQLQIEISA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CNC(=O)[CH](CCCCNC(C)=O)NC(C)=O | OpenEye OEToolkits 1.7.6 | CC(=O)NCCCC[C@@H](C(=O)NC)NC(=O)C | OpenEye OEToolkits 1.7.6 | CC(=O)NCCCCC(C(=O)NC)NC(=O)C | CACTVS 3.385 | CNC(=O)[C@H](CCCCNC(C)=O)NC(C)=O |
|
Formula | C11 H21 N3 O3 |
Name | (2S)-2,6-diacetamido-N-methyl-hexanamide |
ChEMBL | |
DrugBank | |
ZINC | ZINC000056870888
|
PDB chain | 7zg2 Chain AAA Residue 204
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|