Structure of PDB 7r0d Chain AAA Binding Site BS01 |
|
|
Ligand ID | RDZ |
InChI | InChI=1S/C10H19O4P/c1-9(2)5-4-6-10(3)7-8-14-15(11,12)13/h5,7H,4,6,8H2,1-3H3,(H2,11,12,13)/b10-7+ |
InChIKey | FFOWJDCTFSWUMJ-JXMROGBWSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | CC(=CCC/C(=C/COP(=O)(O)O)/C)C | CACTVS 3.385 | CC(C)=CCCC(C)=CCO[P](O)(O)=O | OpenEye OEToolkits 2.0.7 | CC(=CCCC(=CCOP(=O)(O)O)C)C | CACTVS 3.385 | CC(C)=CCC\C(C)=C\CO[P](O)(O)=O |
|
Formula | C10 H19 O4 P |
Name | Geranyl phosphate; [(2E)-3,7-dimethylocta-2,6-dienyl] dihydrogen phosphate; [(2~{E})-3,7-dimethylocta-2,6-dienyl] dihydrogen phosphate |
ChEMBL | |
DrugBank | |
ZINC | ZINC000001532829
|
PDB chain | 7r0d Chain AAA Residue 201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
3.6.1.9: nucleotide diphosphatase. |
|
|
|