Structure of PDB 7oes Chain AAA Binding Site BS01 |
|
|
Ligand ID | VBE |
InChI | InChI=1S/C20H25N3O3/c1-14-10-17(12-22(4)19(14)25)20(26)23(13-18(24)21-3)11-15(2)16-8-6-5-7-9-16/h5-10,12,15H,11,13H2,1-4H3,(H,21,24)/t15-/m1/s1 |
InChIKey | HZVLFNBTVSYMSI-OAHLLOKOSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CNC(=O)CN(C[CH](C)c1ccccc1)C(=O)C2=CN(C)C(=O)C(=C2)C | CACTVS 3.385 | CNC(=O)CN(C[C@@H](C)c1ccccc1)C(=O)C2=CN(C)C(=O)C(=C2)C | OpenEye OEToolkits 2.0.7 | CC1=CC(=CN(C1=O)C)C(=O)N(CC(C)c2ccccc2)CC(=O)NC | OpenEye OEToolkits 2.0.7 | CC1=CC(=CN(C1=O)C)C(=O)N(C[C@@H](C)c2ccccc2)CC(=O)NC |
|
Formula | C20 H25 N3 O3 |
Name | 1,5-dimethyl-N-[2-(methylamino)-2-oxidanylidene-ethyl]-6-oxidanylidene-N-[(2S)-2-phenylpropyl]pyridine-3-carboxamide; 1,5-dimethyl-N-(2-(methylamino)-2-oxoethyl)-6-oxo-N-(2-phenylpropyl)-1,6-dihydropyridine-3-carboxamide |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 7oes Chain AAA Residue 505
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|