Structure of PDB 6z84 Chain AAA Binding Site BS01 |
|
|
Ligand ID | QB8 |
InChI | InChI=1S/C20H17N7O/c1-12(28)23-16-3-2-13-6-7-26(17(13)8-16)18-9-19(24-15-4-5-15)27-20(25-18)14(10-21)11-22-27/h2-3,6-9,11,15,24H,4-5H2,1H3,(H,23,28) |
InChIKey | DVDLZLUKYIFIOR-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | CC(=O)Nc1ccc2ccn(c2c1)c3cc(n4c(n3)c(cn4)C#N)NC5CC5 | CACTVS 3.385 | CC(=O)Nc1ccc2ccn(c3cc(NC4CC4)n5ncc(C#N)c5n3)c2c1 |
|
Formula | C20 H17 N7 O |
Name | ~{N}-[1-[3-cyano-7-(cyclopropylamino)pyrazolo[1,5-a]pyrimidin-5-yl]indol-6-yl]ethanamide |
ChEMBL | CHEMBL2062563 |
DrugBank | |
ZINC | ZINC000084653914
|
PDB chain | 6z84 Chain AAA Residue 406
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|