Structure of PDB 9cgl Chain A Binding Site BS01 |
|
|
Ligand ID | A1AWE |
InChI | InChI=1S/C12H13NO6S/c1-8(20-3-2-17-6-14)9-4-11-12(19-7-18-11)5-10(9)13(15)16/h4-6,8H,2-3,7H2,1H3/t8-/m1/s1 |
InChIKey | OAPSBASJSSKBSD-MRVPVSSYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | CC(c1cc2c(cc1[N+](=O)[O-])OCO2)SCCOC=O | OpenEye OEToolkits 2.0.7 | C[C@H](c1cc2c(cc1[N+](=O)[O-])OCO2)SCCOC=O | CACTVS 3.385 | C[CH](SCCOC=O)c1cc2OCOc2cc1[N+]([O-])=O | CACTVS 3.385 | C[C@@H](SCCOC=O)c1cc2OCOc2cc1[N+]([O-])=O | ACDLabs 12.01 | CC(SCCOC=O)c1cc2OCOc2cc1[N+]([O-])=O |
|
Formula | C12 H13 N O6 S |
Name | 2-{[(1R)-1-(6-nitro-2H-1,3-benzodioxol-5-yl)ethyl]sulfanyl}ethyl formate |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 9cgl Chain A Residue 1401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|