Structure of PDB 9c61 Chain A Binding Site BS01 |
|
|
Ligand ID | A1AUU |
InChI | InChI=1S/C19H22FN3O2/c20-14-1-2-17-15(10-14)16(11-22-17)12-4-7-23(8-5-12)19(25)13-3-6-21-18(24)9-13/h1-2,10-13,22H,3-9H2,(H,21,24)/t13-/m1/s1 |
InChIKey | QDBIALQKWZMDJW-CYBMUJFWSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | Fc1ccc2[nH]cc(C3CCN(CC3)C(=O)[CH]4CCNC(=O)C4)c2c1 | OpenEye OEToolkits 2.0.7 | c1cc2c(cc1F)c(c[nH]2)C3CCN(CC3)C(=O)C4CCNC(=O)C4 | OpenEye OEToolkits 2.0.7 | c1cc2c(cc1F)c(c[nH]2)C3CCN(CC3)C(=O)[C@@H]4CCNC(=O)C4 | ACDLabs 12.01 | O=C(C1CC(=O)NCC1)N1CCC(CC1)c1c[NH]c2ccc(F)cc12 | CACTVS 3.385 | Fc1ccc2[nH]cc(C3CCN(CC3)C(=O)[C@@H]4CCNC(=O)C4)c2c1 |
|
Formula | C19 H22 F N3 O2 |
Name | (4R)-4-[4-(5-fluoro-1H-indol-3-yl)piperidine-1-carbonyl]piperidin-2-one |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 9c61 Chain A Residue 2601
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|