Structure of PDB 8wmg Chain A Binding Site BS01 |
|
|
Ligand ID | WRW |
InChI | InChI=1S/C27H18O6/c28-25(29)19-7-1-16(2-8-19)22-13-23(17-3-9-20(10-4-17)26(30)31)15-24(14-22)18-5-11-21(12-6-18)27(32)33/h1-15H,(H,28,29)(H,30,31)(H,32,33) |
InChIKey | SATWKVZGMWCXOJ-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | c1cc(ccc1c2cc(cc(c2)c3ccc(cc3)C(=O)O)c4ccc(cc4)C(=O)O)C(=O)O | CACTVS 3.385 | OC(=O)c1ccc(cc1)c2cc(cc(c2)c3ccc(cc3)C(O)=O)c4ccc(cc4)C(O)=O |
|
Formula | C27 H18 O6 |
Name | 4-[3,5-bis(4-carboxyphenyl)phenyl]benzoic acid; 1,3,5-Tris(4-carboxyphenyl)benzene |
ChEMBL | |
DrugBank | |
ZINC | ZINC000039182154
|
PDB chain | 8wmg Chain A Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|