Structure of PDB 8v6u Chain A Binding Site BS01 |
|
|
Ligand ID | YEQ |
InChI | InChI=1S/C17H21N3O/c1-13(17-18-9-3-10-19-17)20-11-2-4-15(12-20)14-5-7-16(21)8-6-14/h3,5-10,13,15,21H,2,4,11-12H2,1H3/t13-,15+/m1/s1 |
InChIKey | JDCMEPNJYDYSCB-HIFRSBDPSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | CC(c1ncccn1)N2CCCC(C2)c3ccc(cc3)O | CACTVS 3.385 | C[CH](N1CCC[CH](C1)c2ccc(O)cc2)c3ncccn3 | CACTVS 3.385 | C[C@@H](N1CCC[C@@H](C1)c2ccc(O)cc2)c3ncccn3 | OpenEye OEToolkits 2.0.7 | C[C@H](c1ncccn1)N2CCC[C@@H](C2)c3ccc(cc3)O | ACDLabs 12.01 | CC(c1ncccn1)N1CCCC(C1)c1ccc(O)cc1 |
|
Formula | C17 H21 N3 O |
Name | 4-{(3R)-1-[(1R)-1-(pyrimidin-2-yl)ethyl]piperidin-3-yl}phenol |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 8v6u Chain A Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|