Structure of PDB 8uct Chain A Binding Site BS01 |
|
|
Ligand ID | 3YT |
InChI | InChI=1S/C19H23N9O/c20-15-6-1-2-7-16(15)26-19-22-11-14(17(21)29)18(27-19)25-12-4-3-5-13(10-12)28-23-8-9-24-28/h3-5,8-11,15-16H,1-2,6-7,20H2,(H2,21,29)(H2,22,25,26,27)/t15-,16+/m0/s1 |
InChIKey | TXGKRVFSSHPBAJ-JKSUJKDBSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | c1cc(cc(c1)n2nccn2)Nc3c(cnc(n3)NC4CCCCC4N)C(=O)N | ACDLabs 12.01 | O=C(N)c1cnc(nc1Nc2cccc(c2)n3nccn3)NC4CCCCC4N | CACTVS 3.385 | N[C@H]1CCCC[C@H]1Nc2ncc(C(N)=O)c(Nc3cccc(c3)n4nccn4)n2 | OpenEye OEToolkits 1.7.6 | c1cc(cc(c1)n2nccn2)Nc3c(cnc(n3)N[C@@H]4CCCC[C@@H]4N)C(=O)N | CACTVS 3.385 | N[CH]1CCCC[CH]1Nc2ncc(C(N)=O)c(Nc3cccc(c3)n4nccn4)n2 |
|
Formula | C19 H23 N9 O |
Name | 2-{[(1R,2S)-2-aminocyclohexyl]amino}-4-{[3-(2H-1,2,3-triazol-2-yl)phenyl]amino}pyrimidine-5-carboxamide |
ChEMBL | CHEMBL2177736 |
DrugBank | |
ZINC | ZINC000095572830
|
PDB chain | 8uct Chain A Residue 604
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
2.7.11.1: non-specific serine/threonine protein kinase. |
|
|
|