Structure of PDB 8t69 Chain A Binding Site BS01 |
|
|
Ligand ID | YHL |
InChI | InChI=1S/C19H27NO3/c1-12(2)7-14-11-20-6-5-13-8-18(22-3)19(23-4)9-15(13)16(20)10-17(14)21/h8-9,12,14,16H,5-7,10-11H2,1-4H3/t14-,16-/m1/s1 |
InChIKey | MKJIEFSOBYUXJB-GDBMZVCRSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | COc1cc2CCN3C[C@@H](CC(C)C)C(=O)C[C@@H]3c2cc1OC | OpenEye OEToolkits 2.0.7 | CC(C)C[C@@H]1CN2CCc3cc(c(cc3[C@H]2CC1=O)OC)OC | CACTVS 3.385 | COc1cc2CCN3C[CH](CC(C)C)C(=O)C[CH]3c2cc1OC | OpenEye OEToolkits 2.0.7 | CC(C)CC1CN2CCc3cc(c(cc3C2CC1=O)OC)OC | ACDLabs 12.01 | CC(C)CC1CN2CCc3cc(OC)c(OC)cc3C2CC1=O |
|
Formula | C19 H27 N O3 |
Name | tetrabenazine; (3R,5R,11bR)-9,10-dimethoxy-3-(2-methylpropyl)-1,3,4,6,7,11b-hexahydro-2H-pyrido[2,1-a]isoquinolin-2-one |
ChEMBL | CHEMBL61636 |
DrugBank | |
ZINC | ZINC000000000751
|
PDB chain | 8t69 Chain A Residue 901
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|