Structure of PDB 8skh Chain A Binding Site BS01 |
|
|
Ligand ID | A1W |
InChI | InChI=1S/C23H19ClN2O/c24-16-20(27)26-23(19-14-8-3-9-15-19)21(17-10-4-1-5-11-17)22(25-26)18-12-6-2-7-13-18/h1-15,21,23H,16H2/t21-,23-/m0/s1 |
InChIKey | KRLGZQHRFNNZBX-GMAHTHKFSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | ClCC(=O)N1N=C([CH]([CH]1c2ccccc2)c3ccccc3)c4ccccc4 | CACTVS 3.385 | ClCC(=O)N1N=C([C@@H]([C@@H]1c2ccccc2)c3ccccc3)c4ccccc4 | OpenEye OEToolkits 2.0.7 | c1ccc(cc1)C2C(N(N=C2c3ccccc3)C(=O)CCl)c4ccccc4 | ACDLabs 12.01 | O=C(CCl)N1N=C(c2ccccc2)C(C1c1ccccc1)c1ccccc1 | OpenEye OEToolkits 2.0.7 | c1ccc(cc1)[C@@H]2[C@@H](N(N=C2c3ccccc3)C(=O)CCl)c4ccccc4 |
|
Formula | C23 H19 Cl N2 O |
Name | 2-chloro-1-[(4R,5R)-3,4,5-triphenyl-4,5-dihydro-1H-pyrazol-1-yl]ethan-1-one |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 8skh Chain A Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|