Structure of PDB 8sdv Chain A Binding Site BS01 |
|
|
Ligand ID | ZXM |
InChI | InChI=1S/C11H13BN4O5S/c17-10(4-7-2-1-3-22-7)13-9(12(20)21)6-16-5-8(11(18)19)14-15-16/h1-3,5,9,20-21H,4,6H2,(H,13,17)(H,18,19)/t9-/m0/s1 |
InChIKey | ZXGRTNOGXAKRBS-VIFPVBQESA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.9.2 | B(C(Cn1cc(nn1)C(=O)O)NC(=O)Cc2cccs2)(O)O | CACTVS 3.385 | OB(O)[C@H](Cn1cc(nn1)C(O)=O)NC(=O)Cc2sccc2 | ACDLabs 12.01 | O=C(NC(B(O)O)Cn1nnc(C(=O)O)c1)Cc2sccc2 | OpenEye OEToolkits 1.9.2 | B([C@H](Cn1cc(nn1)C(=O)O)NC(=O)Cc2cccs2)(O)O | CACTVS 3.385 | OB(O)[CH](Cn1cc(nn1)C(O)=O)NC(=O)Cc2sccc2 |
|
Formula | C11 H13 B N4 O5 S |
Name | 1-{(2R)-2-(dihydroxyboranyl)-2-[(thiophen-2-ylacetyl)amino]ethyl}-1H-1,2,3-triazole-4-carboxylic acid |
ChEMBL | CHEMBL3586553 |
DrugBank | |
ZINC | ZINC000207098125
|
PDB chain | 8sdv Chain A Residue 402
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
3.5.2.6: beta-lactamase. |
|
|
|