Structure of PDB 8s8x Chain A Binding Site BS01 |
|
|
Ligand ID | TO1 |
InChI | InChI=1S/C12H13N5O4/c13-1-5-2-17(11-7(5)10(14)15-4-16-11)12-9(20)8(19)6(3-18)21-12/h2,4,6,8-9,12,18-20H,3H2,(H2,14,15,16)/t6-,8-,9-,12-/m1/s1 |
InChIKey | XOKJUSAYZUAMGJ-WOUKDFQISA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | Nc1ncnc2n(cc(C#N)c12)[CH]3O[CH](CO)[CH](O)[CH]3O | CACTVS 3.370 | Nc1ncnc2n(cc(C#N)c12)[C@@H]3O[C@H](CO)[C@@H](O)[C@H]3O | ACDLabs 12.01 | N#Cc2c1c(ncnc1n(c2)C3OC(C(O)C3O)CO)N | OpenEye OEToolkits 1.7.2 | c1c(c2c(ncnc2n1C3C(C(C(O3)CO)O)O)N)C#N | OpenEye OEToolkits 1.7.2 | c1c(c2c(ncnc2n1[C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)O)N)C#N |
|
Formula | C12 H13 N5 O4 |
Name | 4-amino-7-(beta-D-ribofuranosyl)-7H-pyrrolo[2,3-d]pyrimidine-5-carbonitrile; TOYOCAMYCIN |
ChEMBL | CHEMBL99668 |
DrugBank | DB13916 |
ZINC | ZINC000004217594
|
PDB chain | 8s8x Chain A Residue 7202
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|