Structure of PDB 8rai Chain A Binding Site BS01 |
|
|
Ligand ID | ZXN |
InChI | InChI=1S/C14H16N3O5P/c1-10-14(18)13(8-16-17-12-5-3-2-4-6-12)11(7-15-10)9-22-23(19,20)21/h2-8,17-18H,9H2,1H3,(H2,19,20,21)/b16-8+ |
InChIKey | VZZGBIJWEDOPQL-LZYBPNLTSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | Cc1c(c(c(cn1)COP(=O)(O)O)/C=N/Nc2ccccc2)O | OpenEye OEToolkits 2.0.7 | Cc1c(c(c(cn1)COP(=O)(O)O)C=NNc2ccccc2)O | CACTVS 3.385 | Cc1ncc(CO[P](O)(O)=O)c(C=NNc2ccccc2)c1O | CACTVS 3.385 | Cc1ncc(CO[P](O)(O)=O)c(/C=N/Nc2ccccc2)c1O |
|
Formula | C14 H16 N3 O5 P |
Name | [6-methyl-5-oxidanyl-4-[(2-phenylhydrazinyl)methyl]pyridin-3-yl]methyl dihydrogen phosphate |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 8rai Chain A Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|