Structure of PDB 8r6q Chain A Binding Site BS01 |
|
|
Ligand ID | WEW |
InChI | InChI=1S/C29H31ClN2O5/c1-35-26-15-19(5-6-21(26)17-32-11-9-22(18-32)29(34)31-10-12-33)23-3-2-4-24(28(23)30)20-7-8-25-27(16-20)37-14-13-36-25/h2-8,15-16,22,33H,9-14,17-18H2,1H3,(H,31,34)/t22-/m1/s1 |
InChIKey | PVCAFYFKPDWOQM-JOCHJYFZSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | COc1cc(ccc1CN2CC[C@H](C2)C(=O)NCCO)c3cccc(c3Cl)c4ccc5OCCOc5c4 | CACTVS 3.385 | COc1cc(ccc1CN2CC[CH](C2)C(=O)NCCO)c3cccc(c3Cl)c4ccc5OCCOc5c4 | OpenEye OEToolkits 2.0.7 | COc1cc(ccc1CN2CCC(C2)C(=O)NCCO)c3cccc(c3Cl)c4ccc5c(c4)OCCO5 | OpenEye OEToolkits 2.0.7 | COc1cc(ccc1CN2CC[C@H](C2)C(=O)NCCO)c3cccc(c3Cl)c4ccc5c(c4)OCCO5 |
|
Formula | C29 H31 Cl N2 O5 |
Name | (3~{R})-1-[[4-[2-chloranyl-3-(2,3-dihydro-1,4-benzodioxin-6-yl)phenyl]-2-methoxy-phenyl]methyl]-~{N}-(2-hydroxyethyl)pyrrolidine-3-carboxamide |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 8r6q Chain A Residue 201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|