Structure of PDB 8r42 Chain A Binding Site BS01 |
|
|
Ligand ID | XUC |
InChI | InChI=1S/C21H26ClN3/c22-18-8-6-17(7-9-18)16-20-4-3-13-25(20)19-10-14-24(15-11-19)21-5-1-2-12-23-21/h1-2,5-9,12,19-20H,3-4,10-11,13-16H2/t20-/m1/s1 |
InChIKey | XCVVDQHGTQAUAD-HXUWFJFHSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | c1ccnc(c1)N2CCC(CC2)N3CCC[C@@H]3Cc4ccc(cc4)Cl | CACTVS 3.385 | Clc1ccc(C[C@H]2CCCN2C3CCN(CC3)c4ccccn4)cc1 | OpenEye OEToolkits 2.0.7 | c1ccnc(c1)N2CCC(CC2)N3CCCC3Cc4ccc(cc4)Cl | CACTVS 3.385 | Clc1ccc(C[CH]2CCCN2C3CCN(CC3)c4ccccn4)cc1 |
|
Formula | C21 H26 Cl N3 |
Name | 2-[4-[(2~{R})-2-[(4-chlorophenyl)methyl]pyrrolidin-1-yl]piperidin-1-yl]pyridine |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 8r42 Chain A Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|