Structure of PDB 8q5l Chain A Binding Site BS01 |
|
|
Ligand ID | JVO |
InChI | InChI=1S/C21H23ClN4O2/c1-14(2)26-20-11-16(22)5-8-19(20)25-21(26)24-12-17(27)13-28-18-6-3-15(4-7-18)9-10-23/h3-8,11,14,17,27H,9,12-13H2,1-2H3,(H,24,25)/t17-/m0/s1 |
InChIKey | SYDWHCIVWIRKCC-KRWDZBQOSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | CC(C)n1c2cc(ccc2nc1NCC(COc3ccc(cc3)CC#N)O)Cl | OpenEye OEToolkits 2.0.7 | CC(C)n1c2cc(ccc2nc1NC[C@@H](COc3ccc(cc3)CC#N)O)Cl | CACTVS 3.385 | CC(C)n1c(NC[CH](O)COc2ccc(CC#N)cc2)nc3ccc(Cl)cc13 | CACTVS 3.385 | CC(C)n1c(NC[C@H](O)COc2ccc(CC#N)cc2)nc3ccc(Cl)cc13 |
|
Formula | C21 H23 Cl N4 O2 |
Name | 2-[4-[(2~{S})-3-[(6-chloranyl-1-propan-2-yl-benzimidazol-2-yl)amino]-2-oxidanyl-propoxy]phenyl]ethanenitrile |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 8q5l Chain A Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|