Structure of PDB 8q5k Chain A Binding Site BS01 |
|
|
Ligand ID | JTI |
InChI | InChI=1S/C21H23ClN4O3/c1-28-11-10-26-20-12-16(22)4-7-19(20)25-21(26)24-13-17(27)14-29-18-5-2-15(3-6-18)8-9-23/h2-7,12,17,27H,8,10-11,13-14H2,1H3,(H,24,25)/t17-/m0/s1 |
InChIKey | MZCRDZUXHLAMCH-KRWDZBQOSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | COCCn1c(NC[CH](O)COc2ccc(CC#N)cc2)nc3ccc(Cl)cc13 | CACTVS 3.385 | COCCn1c(NC[C@H](O)COc2ccc(CC#N)cc2)nc3ccc(Cl)cc13 | OpenEye OEToolkits 2.0.7 | COCCn1c2cc(ccc2nc1NC[C@@H](COc3ccc(cc3)CC#N)O)Cl | OpenEye OEToolkits 2.0.7 | COCCn1c2cc(ccc2nc1NCC(COc3ccc(cc3)CC#N)O)Cl |
|
Formula | C21 H23 Cl N4 O3 |
Name | 2-[4-[(2~{S})-3-[[6-chloranyl-1-(2-methoxyethyl)benzimidazol-2-yl]amino]-2-oxidanyl-propoxy]phenyl]ethanenitrile |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 8q5k Chain A Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|