Structure of PDB 8px8 Chain A Binding Site BS01 |
|
|
Ligand ID | I0U |
InChI | InChI=1S/C22H25BrN4O2/c1-14-9-17(13-25(3)22(14)29)21-24-19-10-18(23)6-7-20(19)27(21)12-16-5-4-8-26(11-16)15(2)28/h6-7,9-10,13,16H,4-5,8,11-12H2,1-3H3/t16-/m1/s1 |
InChIKey | TWBOQOYETRQSEE-MRXNPFEDSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CN1C=C(C=C(C)C1=O)c2nc3cc(Br)ccc3n2C[CH]4CCCN(C4)C(C)=O | OpenEye OEToolkits 2.0.7 | CC1=CC(=CN(C1=O)C)c2nc3cc(ccc3n2CC4CCCN(C4)C(=O)C)Br | OpenEye OEToolkits 2.0.7 | CC1=CC(=CN(C1=O)C)c2nc3cc(ccc3n2C[C@@H]4CCCN(C4)C(=O)C)Br | CACTVS 3.385 | CN1C=C(C=C(C)C1=O)c2nc3cc(Br)ccc3n2C[C@@H]4CCCN(C4)C(C)=O |
|
Formula | C22 H25 Br N4 O2 |
Name | 5-[5-bromanyl-1-[[(3~{S})-1-ethanoylpiperidin-3-yl]methyl]benzimidazol-2-yl]-1,3-dimethyl-pyridin-2-one |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 8px8 Chain A Residue 503
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|