Structure of PDB 8oza Chain A Binding Site BS01 |
|
|
|
| Ligand ID | WRH |
| InChI | InChI=1S/C19H33N3O6/c1-5-9-20-17(25)14(23)11-15(24)21-16(12(3)6-2)18(26)22-10-7-8-13(22)19(27)28-4/h12-14,16,23H,5-11H2,1-4H3,(H,20,25)(H,21,24)/t12-,13-,14-,16-/m0/s1 |
| InChIKey | BPKXMNJKFGYWKB-YXWQFLTLSA-N |
| SMILES | | Software | SMILES |
|---|
| OpenEye OEToolkits 2.0.7 | CCCNC(=O)C(CC(=O)NC(C(C)CC)C(=O)N1CCCC1C(=O)OC)O | | CACTVS 3.385 | CCCNC(=O)[CH](O)CC(=O)N[CH]([CH](C)CC)C(=O)N1CCC[CH]1C(=O)OC | | CACTVS 3.385 | CCCNC(=O)[C@@H](O)CC(=O)N[C@@H]([C@@H](C)CC)C(=O)N1CCC[C@H]1C(=O)OC | | OpenEye OEToolkits 2.0.7 | CCCNC(=O)[C@H](CC(=O)N[C@@H]([C@@H](C)CC)C(=O)N1CCC[C@H]1C(=O)OC)O |
|
| Formula | C19 H33 N3 O6 |
| Name | methyl (2S)-1-[(2S,3S)-3-methyl-2-[[(3S)-3-oxidanyl-4-oxidanylidene-4-(propylamino)butanoyl]amino]pentanoyl]pyrrolidine-2-carboxylate;
CA-074 methyl ester (bound) |
| ChEMBL | |
| DrugBank | |
| ZINC |
|
| PDB chain | 8oza Chain A Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
| Enzyme Commision number |
3.4.22.15: cathepsin L. |
|
|
|
|
|
