Structure of PDB 8omk Chain A Binding Site BS01 |
|
|
Ligand ID | F1X |
InChI | InChI=1S/C6H13O9P/c7-1-3-4(8)5(9)6(10,15-3)2-14-16(11,12)13/h3-5,7-10H,1-2H2,(H2,11,12,13)/t3-,4-,5+,6-/m1/s1 |
InChIKey | RHKKZBWRNHGJEZ-ARQDHWQXSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | OC[CH]1O[C](O)(CO[P](O)(O)=O)[CH](O)[CH]1O | ACDLabs 12.01 | O=P(OCC1(O)OC(C(O)C1O)CO)(O)O | OpenEye OEToolkits 1.7.0 | C(C1C(C(C(O1)(COP(=O)(O)O)O)O)O)O | OpenEye OEToolkits 1.7.0 | C([C@@H]1[C@H]([C@@H]([C@](O1)(COP(=O)(O)O)O)O)O)O | CACTVS 3.370 | OC[C@H]1O[C@](O)(CO[P](O)(O)=O)[C@@H](O)[C@@H]1O |
|
Formula | C6 H13 O9 P |
Name | 1-O-phosphono-beta-D-fructofuranose; beta D-Fructose 1-phosphate; 1-O-phosphono-beta-D-fructose; 1-O-phosphono-D-fructose; 1-O-phosphono-fructose |
ChEMBL | CHEMBL605021 |
DrugBank | |
ZINC | ZINC000004095539
|
PDB chain | 8omk Chain A Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
2.7.1.3: ketohexokinase. |
|
|
|