Structure of PDB 8k3b Chain A Binding Site BS01 |
|
|
Ligand ID | ELE |
InChI | InChI=1S/C6H11O9P/c7-3(1-4(8)6(10)11)5(9)2-15-16(12,13)14/h3,5,7,9H,1-2H2,(H,10,11)(H2,12,13,14)/t3-,5+/m0/s1 |
InChIKey | OVPRPPOVAXRCED-WVZVXSGGSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | O[C@H](CO[P](O)(O)=O)[C@@H](O)CC(=O)C(O)=O | OpenEye OEToolkits 2.0.6 | C([C@@H]([C@@H](COP(=O)(O)O)O)O)C(=O)C(=O)O | OpenEye OEToolkits 2.0.6 | C(C(C(COP(=O)(O)O)O)O)C(=O)C(=O)O | CACTVS 3.385 | O[CH](CO[P](O)(O)=O)[CH](O)CC(=O)C(O)=O |
|
Formula | C6 H11 O9 P |
Name | 2-keto 3 deoxy 6 phospho gluconate |
ChEMBL | CHEMBL1162150 |
DrugBank | |
ZINC |
|
PDB chain | 8k3b Chain A Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|