Structure of PDB 8ix8 Chain A Binding Site BS01 |
|
|
Ligand ID | TEB |
InChI | InChI=1S/C16H23N3O4S2/c1-8-12(11(7-20)9(2)21)18-13(15(22)23)14(8)25-10-5-19(6-10)16-17-3-4-24-16/h7-12,18,21H,3-6H2,1-2H3,(H,22,23)/t8-,9-,11-,12-/m1/s1 |
InChIKey | PGCJBZBFZXWIGF-CNVPUSNMSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | C[CH](O)[CH](C=O)[CH]1NC(=C(SC2CN(C2)C3=NCCS3)[CH]1C)C(O)=O | CACTVS 3.370 | C[C@@H](O)[C@@H](C=O)[C@@H]1NC(=C(SC2CN(C2)C3=NCCS3)[C@@H]1C)C(O)=O | OpenEye OEToolkits 1.7.6 | C[C@@H]1[C@@H](NC(=C1SC2CN(C2)C3=NCCS3)C(=O)O)[C@H](C=O)[C@@H](C)O | OpenEye OEToolkits 1.7.6 | CC1C(NC(=C1SC2CN(C2)C3=NCCS3)C(=O)O)C(C=O)C(C)O | ACDLabs 12.01 | O=C(O)C=3NC(C(C=O)C(O)C)C(C=3SC2CN(C1=NCCS1)C2)C |
|
Formula | C16 H23 N3 O4 S2 |
Name | (4R,5S)-3-(1-(4,5-dihydrothiazol-2-yl)azetidin-3-ylthio)-5-((2S,3R)-3-hydroxy-1-oxobutan-2-yl)-4-methyl-4,5- dihydro-1H-pyrrole-2-carboxylic acid; Tebipenem (open form) |
ChEMBL | |
DrugBank | |
ZINC | ZINC000103557892
|
PDB chain | 8ix8 Chain A Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
3.5.2.6: beta-lactamase. |
|
|
|