Structure of PDB 8ivh Chain A Binding Site BS01 |
|
|
Ligand ID | R4O |
InChI | InChI=1S/C12H13N5O6S2/c1-6-13-10(16-12(14-6)23-3)15-11(19)17-25(20,21)7-4-5-24-8(7)9(18)22-2/h4-5H,1-3H3,(H2,13,14,15,16,17,19) |
InChIKey | AHTPATJNIAFOLR-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | Cc1nc(nc(n1)OC)NC(=O)NS(=O)(=O)c2ccsc2C(=O)OC | CACTVS 3.385 | COC(=O)c1sccc1[S](=O)(=O)NC(=O)Nc2nc(C)nc(OC)n2 |
|
Formula | C12 H13 N5 O6 S2 |
Name | methyl 3-[(4-methoxy-6-methyl-1,3,5-triazin-2-yl)carbamoylsulfamoyl]thiophene-2-carboxylate; Thifensulfuron-methyl |
ChEMBL | CHEMBL1904815 |
DrugBank | |
ZINC | ZINC000001532076
|
PDB chain | 8ivh Chain A Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|