Structure of PDB 8hei Chain A Binding Site BS01 |
|
|
Ligand ID | E6D |
InChI | InChI=1S/C17H32N2O5/c1-6-24-15(21)10-14(20)17(23)19-13(9-12(4)5)16(22)18-8-7-11(2)3/h11-14,20H,6-10H2,1-5H3,(H,18,22)(H,19,23)/t13-,14-/m0/s1 |
InChIKey | FGRTVYZNNRCSAS-KBPBESRZSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | CCOC(=O)CC(C(=O)NC(CC(C)C)C(=O)NCCC(C)C)O | CACTVS 3.385 | CCOC(=O)C[CH](O)C(=O)N[CH](CC(C)C)C(=O)NCCC(C)C | OpenEye OEToolkits 2.0.6 | CCOC(=O)C[C@@H](C(=O)N[C@@H](CC(C)C)C(=O)NCCC(C)C)O | CACTVS 3.385 | CCOC(=O)C[C@H](O)C(=O)N[C@@H](CC(C)C)C(=O)NCCC(C)C | ACDLabs 12.01 | CC(C)CCNC(=O)C(CC(C)C)NC(=O)C(O)CC(=O)OCC |
|
Formula | C17 H32 N2 O5 |
Name | ethyl (3S)-3-hydroxy-4-({(2S)-4-methyl-1-[(3-methylbutyl)amino]-1-oxopentan-2-yl}amino)-4-oxobutanoate |
ChEMBL | |
DrugBank | |
ZINC | ZINC000584905547
|
PDB chain | 8hei Chain A Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
3.4.22.1: cathepsin B. |
|
|
|