Structure of PDB 8gtu Chain A Binding Site BS01 |
|
|
Ligand ID | KG2 |
InChI | InChI=1S/C22H26NO3/c1-23-14-12-17(13-15-23)20(16-23)26-21(24)22(25,18-8-4-2-5-9-18)19-10-6-3-7-11-19/h2-11,17,20,25H,12-16H2,1H3/q+1/t17-,20-,23+/m1/s1 |
InChIKey | HOOSGZJRQIVJSZ-LLBVYWAGSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | C[N+]12CCC(CC1)[CH](C2)OC(=O)C(O)(c3ccccc3)c4ccccc4 | CACTVS 3.385 | C[N+]12CCC(CC1)[C@@H](C2)OC(=O)C(O)(c3ccccc3)c4ccccc4 | OpenEye OEToolkits 2.0.7 | C[N+]12CCC(CC1)[C@@H](C2)OC(=O)C(c3ccccc3)(c4ccccc4)O | OpenEye OEToolkits 2.0.7 | C[N+]12CCC(CC1)C(C2)OC(=O)C(c3ccccc3)(c4ccccc4)O |
|
Formula | C22 H26 N O3 |
Name | [(3~{S})-1-methyl-1-azoniabicyclo[2.2.2]octan-3-yl] 2-oxidanyl-2,2-diphenyl-ethanoate |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 8gtu Chain A Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|