Structure of PDB 8gl9 Chain A Binding Site BS01 |
|
|
Ligand ID | ZQW |
InChI | InChI=1S/C28H24N2O5/c31-26(32)18-17-24(30-27(33)22-14-8-10-19-9-4-5-13-21(19)22)28(34)29-23-15-6-7-16-25(23)35-20-11-2-1-3-12-20/h1-16,24H,17-18H2,(H,29,34)(H,30,33)(H,31,32)/t24-/m0/s1 |
InChIKey | IIQXEGLQYMXTEV-DEOSSOPVSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | c1ccc(cc1)Oc2ccccc2NC(=O)C(CCC(=O)O)NC(=O)c3cccc4c3cccc4 | CACTVS 3.385 | OC(=O)CC[CH](NC(=O)c1cccc2ccccc12)C(=O)Nc3ccccc3Oc4ccccc4 | ACDLabs 12.01 | O=C(O)CCC(NC(=O)c1cccc2ccccc21)C(=O)Nc1ccccc1Oc1ccccc1 | CACTVS 3.385 | OC(=O)CC[C@H](NC(=O)c1cccc2ccccc12)C(=O)Nc3ccccc3Oc4ccccc4 | OpenEye OEToolkits 2.0.7 | c1ccc(cc1)Oc2ccccc2NC(=O)[C@H](CCC(=O)O)NC(=O)c3cccc4c3cccc4 |
|
Formula | C28 H24 N2 O5 |
Name | N~2~-(naphthalene-1-carbonyl)-N-(2-phenoxyphenyl)-L-alpha-glutamine |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 8gl9 Chain A Residue 303
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|