Structure of PDB 8gd4 Chain A Binding Site BS01 |
|
|
Ligand ID | Z4I |
InChI | InChI=1S/C14H13F2N5O2/c15-11(16)13(23)21-20-12(22)10-7-18-14(19-8-10)17-6-9-4-2-1-3-5-9/h1-5,7-8,11H,6H2,(H,20,22)(H,21,23)(H,17,18,19) |
InChIKey | WAERNYVSQGAOPC-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | c1ccc(cc1)CNc2ncc(cn2)C(=O)NNC(=O)C(F)F | ACDLabs 12.01 CACTVS 3.385 | FC(F)C(=O)NNC(=O)c1cnc(NCc2ccccc2)nc1 |
|
Formula | C14 H13 F2 N5 O2 |
Name | 2-(benzylamino)-N'-(difluoroacetyl)pyrimidine-5-carbohydrazide |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 8gd4 Chain A Residue 801
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|