Structure of PDB 8gd0 Chain A Binding Site BS01 |
|
|
Ligand ID | Z3F |
InChI | InChI=1S/C18H24ClFN4O2/c1-22-7-9-23(10-8-22)18(26)24-6-2-3-13(12-24)17(25)21-14-4-5-15(19)16(20)11-14/h4-5,11,13H,2-3,6-10,12H2,1H3,(H,21,25)/t13-/m0/s1 |
InChIKey | KORUUSLMTDCGIB-ZDUSSCGKSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CN1CCN(CC1)C(=O)N2CCC[C@@H](C2)C(=O)Nc3ccc(Cl)c(F)c3 | CACTVS 3.385 | CN1CCN(CC1)C(=O)N2CCC[CH](C2)C(=O)Nc3ccc(Cl)c(F)c3 | OpenEye OEToolkits 2.0.7 | CN1CCN(CC1)C(=O)N2CCCC(C2)C(=O)Nc3ccc(c(c3)F)Cl | OpenEye OEToolkits 2.0.7 | CN1CCN(CC1)C(=O)N2CCC[C@@H](C2)C(=O)Nc3ccc(c(c3)F)Cl | ACDLabs 12.01 | O=C(N1CCN(C)CC1)N1CCCC(C1)C(=O)Nc1ccc(Cl)c(F)c1 |
|
Formula | C18 H24 Cl F N4 O2 |
Name | (3S)-N-(4-chloro-3-fluorophenyl)-1-(4-methylpiperazine-1-carbonyl)piperidine-3-carboxamide |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 8gd0 Chain A Residue 513
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|