Structure of PDB 8fpe Chain A Binding Site BS01 |
|
|
Ligand ID | Y5B |
InChI | InChI=1S/C28H21F6NO3S/c29-27(30,31)26(36,28(32,33)34)23-15-17-24(18-16-23)35(39(37,38)25-9-5-2-6-10-25)19-20-11-13-22(14-12-20)21-7-3-1-4-8-21/h1-18,36H,19H2 |
InChIKey | QNAWYCWKQPMYME-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | OC(c1ccc(cc1)N(Cc2ccc(cc2)c3ccccc3)[S](=O)(=O)c4ccccc4)(C(F)(F)F)C(F)(F)F | ACDLabs 12.01 | O=S(=O)(N(Cc1ccc(cc1)c1ccccc1)c1ccc(cc1)C(O)(C(F)(F)F)C(F)(F)F)c1ccccc1 | OpenEye OEToolkits 2.0.7 | c1ccc(cc1)c2ccc(cc2)CN(c3ccc(cc3)C(C(F)(F)F)(C(F)(F)F)O)S(=O)(=O)c4ccccc4 |
|
Formula | C28 H21 F6 N O3 S |
Name | N-[([1,1'-biphenyl]-4-yl)methyl]-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]benzenesulfonamide |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 8fpe Chain A Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|