Structure of PDB 8ers Chain A Binding Site BS01 |
|
|
Ligand ID | WQO |
InChI | InChI=1S/C17H15NO5/c18-10-5-6-12(14(19)8-10)17(22)23-15-11-4-2-1-3-9(11)7-13(15)16(20)21/h1-6,8,13,15,19H,7,18H2,(H,20,21)/t13-,15-/m0/s1 |
InChIKey | DWGIEIVAFVJIQU-ZFWWWQNUSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | c1ccc2c(c1)C[C@@H]([C@H]2OC(=O)c3ccc(cc3O)N)C(=O)O | CACTVS 3.385 | Nc1ccc(c(O)c1)C(=O)O[C@@H]2[C@H](Cc3ccccc23)C(O)=O | ACDLabs 12.01 | Nc1ccc(c(O)c1)C(=O)OC1c2ccccc2CC1C(=O)O | CACTVS 3.385 | Nc1ccc(c(O)c1)C(=O)O[CH]2[CH](Cc3ccccc23)C(O)=O | OpenEye OEToolkits 2.0.7 | c1ccc2c(c1)CC(C2OC(=O)c3ccc(cc3O)N)C(=O)O |
|
Formula | C17 H15 N O5 |
Name | (1R,2S)-1-[(4-amino-2-hydroxybenzoyl)oxy]-2,3-dihydro-1H-indene-2-carboxylic acid |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 8ers Chain A Residue 201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|