Structure of PDB 8eip Chain A Binding Site BS01 |
|
|
Ligand ID | 7ID |
InChI | InChI=1S/C10H19N5O5/c11-5(8(17)18)4-7(16)15-6(9(19)20)2-1-3-14-10(12)13/h5-6H,1-4,11H2,(H,15,16)(H,17,18)(H,19,20)(H4,12,13,14)/t5-,6-/m0/s1 |
InChIKey | QCGCETFHYOEVAI-WDSKDSINSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | N[CH](CC(=O)N[CH](CCCNC(N)=N)C(O)=O)C(O)=O | OpenEye OEToolkits 2.0.7 | [H]/N=C(/N)\NCCC[C@@H](C(=O)O)NC(=O)C[C@@H](C(=O)O)N | CACTVS 3.385 | N[C@@H](CC(=O)N[C@@H](CCCNC(N)=N)C(O)=O)C(O)=O | OpenEye OEToolkits 2.0.7 | C(CC(C(=O)O)NC(=O)CC(C(=O)O)N)CNC(=N)N | ACDLabs 12.01 | O=C(NC(CCCNC(=N)N)C(=O)O)CC(N)C(=O)O |
|
Formula | C10 H19 N5 O5 |
Name | (2~{S})-4-[[(2~{S})-5-[[azanyl($l^{4}-azanylidene)methyl]amino]-1-$l^{1}-oxidanyl-1-oxidanylidene-pentan-2-yl]amino]-2-$l^{2}-azanyl-4-oxidanylidene-butanoic acid |
ChEMBL | |
DrugBank | |
ZINC | ZINC000050026817
|
PDB chain | 8eip Chain A Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|