Structure of PDB 8ecg Chain A Binding Site BS01 |
|
|
Ligand ID | PV9 |
InChI | InChI=1S/C25H24FNO4/c26-17-9-7-15(8-10-17)24-20-3-1-2-4-22(20)27-25(16-5-6-16)21(24)12-11-18(28)13-19(29)14-23(30)31/h1-4,7-12,16,18-19,28-29H,5-6,13-14H2,(H,30,31)/b12-11+/t18-,19-/m1/s1 |
InChIKey | VGYFMXBACGZSIL-MCBHFWOFSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | O=C(O)CC(O)CC(O)/C=C/c1c(c2ccccc2nc1C1CC1)c1ccc(F)cc1 | CACTVS 3.385 | O[CH](C[CH](O)C=Cc1c(nc2ccccc2c1c3ccc(F)cc3)C4CC4)CC(O)=O | CACTVS 3.385 | O[C@H](C[C@H](O)/C=C/c1c(nc2ccccc2c1c3ccc(F)cc3)C4CC4)CC(O)=O | OpenEye OEToolkits 2.0.7 | c1ccc2c(c1)c(c(c(n2)C3CC3)C=CC(CC(CC(=O)O)O)O)c4ccc(cc4)F | OpenEye OEToolkits 2.0.7 | c1ccc2c(c1)c(c(c(n2)C3CC3)/C=C/[C@H](C[C@H](CC(=O)O)O)O)c4ccc(cc4)F |
|
Formula | C25 H24 F N O4 |
Name | Pitavastatin; (3R,5S,6E)-7-[2-cyclopropyl-4-(4-fluorophenyl)quinolin-3-yl]-3,5-dihydroxyhept-6-enoic acid |
ChEMBL | CHEMBL1201753 |
DrugBank | DB08860 |
ZINC | ZINC000001534965
|
PDB chain | 8ecg Chain A Residue 602
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
1.1.1.34: hydroxymethylglutaryl-CoA reductase (NADPH). |
|
|
|