Structure of PDB 8dzs Chain A Binding Site BS01 |
|
|
Ligand ID | U9I |
InChI | InChI=1S/C19H25Cl2N3O3/c1-27-19(26)23-8-9-24(15(13-23)12-22-6-2-3-7-22)18(25)11-14-4-5-16(20)17(21)10-14/h4-5,10,15H,2-3,6-9,11-13H2,1H3/t15-/m1/s1 |
InChIKey | HJUAKZYKCANOOZ-OAHLLOKOSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | COC(=O)N1CCN(C(C1)CN2CCCC2)C(=O)Cc3ccc(c(c3)Cl)Cl | CACTVS 3.385 | COC(=O)N1CCN([C@H](CN2CCCC2)C1)C(=O)Cc3ccc(Cl)c(Cl)c3 | ACDLabs 12.01 | Clc1ccc(cc1Cl)CC(=O)N1CCN(CC1CN1CCCC1)C(=O)OC | OpenEye OEToolkits 2.0.7 | COC(=O)N1CCN([C@@H](C1)CN2CCCC2)C(=O)Cc3ccc(c(c3)Cl)Cl | CACTVS 3.385 | COC(=O)N1CCN([CH](CN2CCCC2)C1)C(=O)Cc3ccc(Cl)c(Cl)c3 |
|
Formula | C19 H25 Cl2 N3 O3 |
Name | methyl (3R)-4-[(3,4-dichlorophenyl)acetyl]-3-[(pyrrolidin-1-yl)methyl]piperazine-1-carboxylate |
ChEMBL | CHEMBL277863 |
DrugBank | |
ZINC | ZINC000003792990
|
PDB chain | 8dzs Chain A Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|