Structure of PDB 8dsy Chain A Binding Site BS01 |
|
|
Ligand ID | TJC |
InChI | InChI=1S/C31H33ClN2O4/c1-19-20(2)34(17-22-8-12-26(32)28(14-22)38-18-29(35)36)27-13-9-23(15-25(19)27)30(37)33-16-21-6-10-24(11-7-21)31(3,4)5/h6-15H,16-18H2,1-5H3,(H,33,37)(H,35,36) |
InChIKey | QBNWQJLTDJWRLS-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | CC(C)(C)c1ccc(cc1)CNC(=O)c1cc2c(cc1)n(Cc1ccc(Cl)c(OCC(=O)O)c1)c(C)c2C | CACTVS 3.385 | Cc1n(Cc2ccc(Cl)c(OCC(O)=O)c2)c3ccc(cc3c1C)C(=O)NCc4ccc(cc4)C(C)(C)C | OpenEye OEToolkits 2.0.7 | Cc1c(n(c2c1cc(cc2)C(=O)NCc3ccc(cc3)C(C)(C)C)Cc4ccc(c(c4)OCC(=O)O)Cl)C |
|
Formula | C31 H33 Cl N2 O4 |
Name | {5-[(5-{[(4-tert-butylphenyl)methyl]carbamoyl}-2,3-dimethyl-1H-indol-1-yl)methyl]-2-chlorophenoxy}acetic acid |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 8dsy Chain A Residue 601
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|