Structure of PDB 8dp7 Chain A Binding Site BS01 |
|
|
Ligand ID | LW8 |
InChI | InChI=1S/C9H15N3O2S/c1-12(2,3)7(8(13)14)4-6-5-10-9(15)11-6/h5,7H,4H2,1-3H3,(H2-,10,11,13,14,15)/p+1/t7-/m0/s1 |
InChIKey | SSISHJJTAXXQAX-ZETCQYMHSA-O |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | C[N+](C)(C)[C@@H](CC1=CNC(=S)N1)C(=O)O | OpenEye OEToolkits 2.0.7 | C[N+](C)(C)C(CC1=CNC(=S)N1)C(=O)O | CACTVS 3.385 | C[N+](C)(C)[CH](CC1=CNC(=S)N1)C(O)=O | CACTVS 3.385 | C[N+](C)(C)[C@@H](CC1=CNC(=S)N1)C(O)=O |
|
Formula | C9 H16 N3 O2 S |
Name | trimethyl-[(2S)-1-oxidanyl-1-oxidanylidene-3-(2-sulfanylidene-1,3-dihydroimidazol-4-yl)propan-2-yl]azanium |
ChEMBL | CHEMBL4303270 |
DrugBank | |
ZINC | ZINC000001530224
|
PDB chain | 8dp7 Chain A Residue 601
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|