Structure of PDB 8dc8 Chain A Binding Site BS01 |
|
|
Ligand ID | R50 |
InChI | InChI=1S/C22H25N3O/c1-14(2)22(26)25-12-15(3)21-19(10-23-11-20(21)25)17-5-6-18-13-24(4)8-7-16(18)9-17/h5-6,9-12,14H,7-8,13H2,1-4H3 |
InChIKey | LCCGCNQOVLMABP-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | CC(C)C(=O)n1cc(C)c2c1cncc2c1ccc2CN(C)CCc2c1 | CACTVS 3.385 | CC(C)C(=O)n1cc(C)c2c1cncc2c3ccc4CN(C)CCc4c3 | OpenEye OEToolkits 2.0.7 | Cc1cn(c2c1c(cnc2)c3ccc4c(c3)CCN(C4)C)C(=O)C(C)C |
|
Formula | C22 H25 N3 O |
Name | 2-methyl-1-[(4P)-3-methyl-4-(2-methyl-1,2,3,4-tetrahydroisoquinolin-6-yl)-1H-pyrrolo[2,3-c]pyridin-1-yl]prop-2-en-1-one, bound form |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 8dc8 Chain A Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|