Structure of PDB 8cvh Chain A Binding Site BS01 |
|
|
Ligand ID | OVR |
InChI | InChI=1S/C17H23NO4/c1-18-12-7-13(9-15(18)16(20)8-12)22-17(21)14(10-19)11-5-3-2-4-6-11/h2-6,12-16,19-20H,7-10H2,1H3/t12-,13-,14+,15+,16-/m0/s1 |
InChIKey | WTQYWNWRJNXDEG-RBZJEDDUSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | CN1C2CC(CC1C(C2)O)OC(=O)C(CO)c3ccccc3 | OpenEye OEToolkits 2.0.7 | CN1[C@H]2C[C@@H](C[C@@H]1[C@H](C2)O)OC(=O)[C@H](CO)c3ccccc3 | CACTVS 3.385 | CN1[C@@H]2C[C@H](O)[C@H]1C[C@H](C2)OC(=O)[C@H](CO)c3ccccc3 | ACDLabs 12.01 | CN1C2CC(CC1C(O)C2)OC(=O)C(CO)c1ccccc1 | CACTVS 3.385 | CN1[CH]2C[CH](O)[CH]1C[CH](C2)OC(=O)[CH](CO)c3ccccc3 |
|
Formula | C17 H23 N O4 |
Name | (1R,3S,5R,6S)-6-hydroxy-8-methyl-8-azabicyclo[3.2.1]octan-3-yl (2S)-3-hydroxy-2-phenylpropanoate |
ChEMBL | CHEMBL2165224 |
DrugBank | DB11785 |
ZINC | ZINC000003197739
|
PDB chain | 8cvh Chain A Residue 409
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
1.14.11.11: hyoscyamine (6S)-dioxygenase. |
|
|
|