Structure of PDB 8ck8 Chain A Binding Site BS01 |
|
|
Ligand ID | UYF |
InChI | InChI=1S/C14H18F2O4S2/c1-22(18,19)13-10-9(7-14(15,16)11(10)17)12(21-13)20-8-5-3-2-4-6-8/h8,11,17H,2-7H2,1H3/t11-/m0/s1 |
InChIKey | VVRLYNNVBDMZCH-NSHDSACASA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | CS(=O)(=O)c1c2c(c(s1)OC3CCCCC3)CC(C2O)(F)F | OpenEye OEToolkits 2.0.7 | CS(=O)(=O)c1c2c(c(s1)OC3CCCCC3)CC([C@H]2O)(F)F | CACTVS 3.385 | C[S](=O)(=O)c1sc(OC2CCCCC2)c3CC(F)(F)[CH](O)c13 | CACTVS 3.385 | C[S](=O)(=O)c1sc(OC2CCCCC2)c3CC(F)(F)[C@@H](O)c13 |
|
Formula | C14 H18 F2 O4 S2 |
Name | (4~{S})-1-cyclohexyloxy-5,5-bis(fluoranyl)-3-methylsulfonyl-4,6-dihydrocyclopenta[c]thiophen-4-ol |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 8ck8 Chain A Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|