Structure of PDB 8ck4 Chain A Binding Site BS01 |
|
|
Ligand ID | UY3 |
InChI | InChI=1S/C15H12F4O3S2/c1-24(21,22)14-11-10(2-3-15(18,19)13(11)20)12(23-14)7-4-8(16)6-9(17)5-7/h4-6,13,20H,2-3H2,1H3/t13-/m0/s1 |
InChIKey | SSIWQCYLGHKCQZ-ZDUSSCGKSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | CS(=O)(=O)c1c2c(c(s1)c3cc(cc(c3)F)F)CCC([C@H]2O)(F)F | CACTVS 3.385 | C[S](=O)(=O)c1sc(c2CCC(F)(F)[C@@H](O)c12)c3cc(F)cc(F)c3 | CACTVS 3.385 | C[S](=O)(=O)c1sc(c2CCC(F)(F)[CH](O)c12)c3cc(F)cc(F)c3 | OpenEye OEToolkits 2.0.7 | CS(=O)(=O)c1c2c(c(s1)c3cc(cc(c3)F)F)CCC(C2O)(F)F |
|
Formula | C15 H12 F4 O3 S2 |
Name | (4~{S})-1-[3,5-bis(fluoranyl)phenyl]-5,5-bis(fluoranyl)-3-methylsulfonyl-6,7-dihydro-4~{H}-2-benzothiophen-4-ol |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 8ck4 Chain A Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|