Structure of PDB 8ck3 Chain A Binding Site BS01 |
|
|
Ligand ID | UXU |
InChI | InChI=1S/C14H10F4O3S2/c1-23(20,21)13-10-9(5-14(17,18)12(10)19)11(22-13)6-2-7(15)4-8(16)3-6/h2-4,12,19H,5H2,1H3/t12-/m0/s1 |
InChIKey | UWHUYKGCGHNLEP-LBPRGKRZSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | C[S](=O)(=O)c1sc(c2CC(F)(F)[CH](O)c12)c3cc(F)cc(F)c3 | CACTVS 3.385 | C[S](=O)(=O)c1sc(c2CC(F)(F)[C@@H](O)c12)c3cc(F)cc(F)c3 | OpenEye OEToolkits 2.0.7 | CS(=O)(=O)c1c2c(c(s1)c3cc(cc(c3)F)F)CC(C2O)(F)F | OpenEye OEToolkits 2.0.7 | CS(=O)(=O)c1c2c(c(s1)c3cc(cc(c3)F)F)CC([C@H]2O)(F)F |
|
Formula | C14 H10 F4 O3 S2 |
Name | (4~{S})-1-[3,5-bis(fluoranyl)phenyl]-5,5-bis(fluoranyl)-3-methylsulfonyl-4,6-dihydrocyclopenta[c]thiophen-4-ol |
ChEMBL | CHEMBL4639113 |
DrugBank | |
ZINC |
|
PDB chain | 8ck3 Chain A Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|