Structure of PDB 8cbu Chain A Binding Site BS01 |
|
|
Ligand ID | U60 |
InChI | InChI=1S/C25H28O4/c1-14-5-10-20(16-6-7-16)23(22(14)24(25(26)27)29-17-8-9-17)19-11-12-21-18(15(19)2)4-3-13-28-21/h5,10-12,16-17,24H,3-4,6-9,13H2,1-2H3,(H,26,27)/t24-/m0/s1 |
InChIKey | ZNMXSKRQRZHGAE-DEOSSOPVSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | Cc1ccc(C2CC2)c(c3ccc4OCCCc4c3C)c1[C@H](OC5CC5)C(O)=O | OpenEye OEToolkits 2.0.7 | Cc1ccc(c(c1[C@@H](C(=O)O)OC2CC2)c3ccc4c(c3C)CCCO4)C5CC5 | OpenEye OEToolkits 2.0.7 | Cc1ccc(c(c1C(C(=O)O)OC2CC2)c3ccc4c(c3C)CCCO4)C5CC5 | CACTVS 3.385 | Cc1ccc(C2CC2)c(c3ccc4OCCCc4c3C)c1[CH](OC5CC5)C(O)=O |
|
Formula | C25 H28 O4 |
Name | (2S)-2-[3-cyclopropyl-6-methyl-2-(5-methyl-3,4-dihydro-2H-chromen-6-yl)phenyl]-2-cyclopropyloxy-ethanoic acid |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 8cbu Chain D Residue 601
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|