Structure of PDB 8c6d Chain A Binding Site BS01 |
|
|
Ligand ID | SQS |
InChI | InChI=1S/C18H37NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-18(21)17(19)16-20/h14-15,17-18,20-21H,2-13,16,19H2,1H3/b15-14+/t17-,18+/m0/s1 |
InChIKey | WWUZIQQURGPMPG-KRWOKUGFSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | CCCCCCCCCCCCCC=CC(C(CO)N)O | CACTVS 3.370 | CCCCCCCCCCCCCC=C[CH](O)[CH](N)CO | ACDLabs 12.01 | OCC(N)C(O)/C=C/CCCCCCCCCCCCC | OpenEye OEToolkits 1.7.6 | CCCCCCCCCCCCC/C=C/[C@H]([C@H](CO)N)O | CACTVS 3.370 | CCCCCCCCCCCCC/C=C/[C@@H](O)[C@@H](N)CO |
|
Formula | C18 H37 N O2 |
Name | (2S,3R,4E)-2-aminooctadec-4-ene-1,3-diol; D-Sphingosine |
ChEMBL | CHEMBL67166 |
DrugBank | DB03203 |
ZINC | ZINC000008195650
|
PDB chain | 8c6d Chain A Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|