Structure of PDB 8bzy Chain A Binding Site BS01 |
|
|
Ligand ID | SZU |
InChI | InChI=1S/C21H21FN6O2/c22-14-4-3-9-24-17(14)12-25-21(29)18-13-30-20(28-18)8-11-23-10-7-19-26-15-5-1-2-6-16(15)27-19/h1-6,9,13,23H,7-8,10-12H2,(H,25,29)(H,26,27) |
InChIKey | KNYVRFXIVWUGBZ-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | c1ccc2c(c1)[nH]c(n2)CCNCCc3nc(co3)C(=O)NCc4c(cccn4)F | CACTVS 3.385 | Fc1cccnc1CNC(=O)c2coc(CCNCCc3[nH]c4ccccc4n3)n2 |
|
Formula | C21 H21 F N6 O2 |
Name | 2-[2-[2-(1~{H}-benzimidazol-2-yl)ethylamino]ethyl]-~{N}-[(3-fluoranylpyridin-2-yl)methyl]-1,3-oxazole-4-carboxamide |
ChEMBL | CHEMBL4596566 |
DrugBank | DB17692 |
ZINC |
|
PDB chain | 8bzy Chain A Residue 602
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|